C14H19FN6O6 — CID 164881727
[(2S,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 164881727) has the molecular formula C14H19FN6O6 and a molecular weight of 386.34 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2S,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 164881727 |
| Molecular Formula | C14H19FN6O6 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-5-cyano-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@@]1(F)O[C@@](C#N)(n2ncc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19FN6O6/c1-6(2)8(18)11(24)26-5-13(15)9(22)10(23)14(4-16,27-13)21-12(25)20-7(17)3-19-21/h3,6,8-10,22-23H,5,18H2,1-2H3,(H2,17,20,25)/t8-,9-,10+,13+,14+/m0/s1 |
| InChIKey | POBDAGSCNPIAIK-XSYNQRDESA-N |
| XLogP | -2.66 |
| TPSA | 199.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |