C17H23FN4O7 — CID 164881879
[(2S,3S,4R,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 164881879) has the molecular formula C17H23FN4O7 and a molecular weight of 414.39 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2S,3S,4R,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 164881879 |
| Molecular Formula | C17H23FN4O7 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(4-amino-5-ethynyl-2-oxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | C#Cc1cn([C@]2(CO)O[C@](F)(COC(=O)[C@@H](N)C(C)C)[C@@H](O)[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C17H23FN4O7/c1-4-9-5-22(15(27)21-13(9)20)17(6-23)12(25)11(24)16(18,29-17)7-28-14(26)10(19)8(2)3/h1,5,8,10-12,23-25H,6-7,19H2,2-3H3,(H2,20,21,27)/t10-,11-,12+,16+,17+/m0/s1 |
| InChIKey | HXELDTMLWFBEQY-MJWVCXPYSA-N |
| XLogP | -2.60 |
| TPSA | 183.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|