C9H11N5O5 — CID 177098038
(2R,4R,5R)-2-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 177098038) has the molecular formula C9H11N5O5 and a molecular weight of 269.22 g/mol. Its IUPAC name is (2R,4R,5R)-2-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,4R,5R)-2-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 177098038 |
| Molecular Formula | C9H11N5O5 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (2R,4R,5R)-2-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@@]1(n2ncc(N)nc2=O)O[C@H](CO)[C@H](O)C1O |
| InChI | InChI=1S/C9H11N5O5/c10-3-9(7(17)6(16)4(2-15)19-9)14-8(18)13-5(11)1-12-14/h1,4,6-7,15-17H,2H2,(H2,11,13,18)/t4-,6+,7?,9-/m1/s1 |
| InChIKey | KKOCLXWNYRILKX-JHHCQCNTSA-N |
| XLogP | -3.49 |
| TPSA | 167.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |