C11H9N3O2S — CID 164888401
7-phenyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-d]pyrimidine-2,5-dione (PubChem CID 164888401) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 7-phenyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-d]pyrimidine-2,5-dione.
| Compound Name | 7-phenyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 164888401 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 7-phenyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-d]pyrimidine-2,5-dione |
| SMILES | O=C1Nc2sc(=O)[nH]c2C(c2ccccc2)N1 |
| InChI | InChI=1S/C11H9N3O2S/c15-10-12-7(6-4-2-1-3-5-6)8-9(14-10)17-11(16)13-8/h1-5,7H,(H,13,16)(H2,12,14,15) |
| InChIKey | NALQKMWUWMHNBC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |