C36H50ClNO — CID 164889115
(2Z,4aR,6aS,6aR,6bR,8aS,14aR,14bR)-8a-(chloromethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2-(pyridin-3-ylmethylidene)-1,4a,5,6,6a,7,8,9,10,13,14,14a-dodecahydropicen-3-one (PubChem CID 164889115) has the molecular formula C36H50ClNO and a molecular weight of 548.26 g/mol. Its IUPAC name is (2Z,4aR,6aS,6aR,6bR,8aS,14aR,14bR)-8a-(chloromethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2-(pyridin-3-ylmethylidene)-1,4a,5,6,6a,7,8,9,10,13,14,14a-dodecahydropicen-3-one.
| Compound Name | (2Z,4aR,6aS,6aR,6bR,8aS,14aR,14bR)-8a-(chloromethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2-(pyridin-3-ylmethylidene)-1,4a,5,6,6a,7,8,9,10,13,14,14a-dodecahydropicen-3-one |
|---|---|
| PubChem CID | 164889115 |
| Molecular Formula | C36H50ClNO |
| Molecular Weight | 548.26 g/mol |
| Exact Mass | 547.36 |
| IUPAC Name | (2Z,4aR,6aS,6aR,6bR,8aS,14aR,14bR)-8a-(chloromethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2-(pyridin-3-ylmethylidene)-1,4a,5,6,6a,7,8,9,10,13,14,14a-dodecahydropicen-3-one |
| SMILES | CC1(C)C=C2[C@H]3CC[C@@H]4[C@@]5(C)C/C(=C/c6cccnc6)C(=O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(CCl)CC1 |
| InChI | InChI=1S/C36H50ClNO/c1-31(2)14-16-36(23-37)17-15-34(6)26(27(36)21-31)10-11-29-33(5)20-25(19-24-9-8-18-38-22-24)30(39)32(3,4)28(33)12-13-35(29,34)7/h8-9,18-19,21-22,26,28-29H,10-17,20,23H2,1-7H3/b25-19-/t26-,28+,29-,33+,34-,35-,36-/m1/s1 |
| InChIKey | MBTQAMXCQIOLNX-YQVVKSAZSA-N |
| XLogP | 9.68 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.26 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|