C14H18N6O3 — CID 164889605
2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one (PubChem CID 164889605) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one.
| Compound Name | 2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
|---|---|
| PubChem CID | 164889605 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
| SMILES | COc1cccc(/C=N/NC2=NC3C(N2)N(C)C(=O)N3C)c1O |
| InChI | InChI=1S/C14H18N6O3/c1-19-11-12(20(2)14(19)22)17-13(16-11)18-15-7-8-5-4-6-9(23-3)10(8)21/h4-7,11-12,21H,1-3H3,(H2,16,17,18)/b15-7+ |
| InChIKey | QBOUHUKXDSZNFK-VIZOYTHASA-N |
| XLogP | -0.07 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|