C13H16N6O2 — CID 164889608
2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one (PubChem CID 164889608) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one.
| Compound Name | 2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
|---|---|
| PubChem CID | 164889608 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-4,6-dimethyl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
| SMILES | CN1C(=O)N(C)C2NC(N/N=C/c3ccccc3O)=NC21 |
| InChI | InChI=1S/C13H16N6O2/c1-18-10-11(19(2)13(18)21)16-12(15-10)17-14-7-8-5-3-4-6-9(8)20/h3-7,10-11,20H,1-2H3,(H2,15,16,17)/b14-7+ |
| InChIKey | BBESPMFLWMBLAG-VGOFMYFVSA-N |
| XLogP | -0.08 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|