C10H11Cl2FO2 — CID 164892826
2,2-dichloro-1-(5-ethoxy-2-fluorophenyl)ethanol (PubChem CID 164892826) has the molecular formula C10H11Cl2FO2 and a molecular weight of 253.10 g/mol. Its IUPAC name is 2,2-dichloro-1-(5-ethoxy-2-fluorophenyl)ethanol.
| Compound Name | 2,2-dichloro-1-(5-ethoxy-2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 164892826 |
| Molecular Formula | C10H11Cl2FO2 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2,2-dichloro-1-(5-ethoxy-2-fluorophenyl)ethanol |
| SMILES | CCOc1ccc(F)c(C(O)C(Cl)Cl)c1 |
| InChI | InChI=1S/C10H11Cl2FO2/c1-2-15-6-3-4-8(13)7(5-6)9(14)10(11)12/h3-5,9-10,14H,2H2,1H3 |
| InChIKey | KKWALCYXYQCWAO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|