C26H38Sn — CID 164897821
1,1,2-tributyl-3-(2-naphthalen-2-ylethyl)stannirene (PubChem CID 164897821) has the molecular formula C26H38Sn and a molecular weight of 469.30 g/mol. Its IUPAC name is 1,1,2-tributyl-3-(2-naphthalen-2-ylethyl)stannirene.
| Compound Name | 1,1,2-tributyl-3-(2-naphthalen-2-ylethyl)stannirene |
|---|---|
| PubChem CID | 164897821 |
| Molecular Formula | C26H38Sn |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 1,1,2-tributyl-3-(2-naphthalen-2-ylethyl)stannirene |
| SMILES | CCCCC1=C(CCc2ccc3ccccc3c2)[Sn]1(CCCC)CCCC |
| InChI | InChI=1S/C18H20.2C4H9.Sn/c1-2-3-4-5-6-7-10-16-13-14-17-11-8-9-12-18(17)15-16;2*1-3-4-2;/h8-9,11-15H,2-4,7,10H2,1H3;2*1,3-4H2,2H3; |
| InChIKey | ILWJTFZSAFQDAT-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |