C22H32N6O4 — CID 164901886
tert-butyl 2-[8-[2-(2,2-dimethylpropanoyl)hydrazinyl]-3-morpholin-4-ylpyrido[2,3-d]pyridazin-5-yl]acetate (PubChem CID 164901886) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is tert-butyl 2-[8-[2-(2,2-dimethylpropanoyl)hydrazinyl]-3-morpholin-4-ylpyrido[2,3-d]pyridazin-5-yl]acetate.
| Compound Name | tert-butyl 2-[8-[2-(2,2-dimethylpropanoyl)hydrazinyl]-3-morpholin-4-ylpyrido[2,3-d]pyridazin-5-yl]acetate |
|---|---|
| PubChem CID | 164901886 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | tert-butyl 2-[8-[2-(2,2-dimethylpropanoyl)hydrazinyl]-3-morpholin-4-ylpyrido[2,3-d]pyridazin-5-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1nnc(NNC(=O)C(C)(C)C)c2ncc(N3CCOCC3)cc12 |
| InChI | InChI=1S/C22H32N6O4/c1-21(2,3)20(30)27-26-19-18-15(11-14(13-23-18)28-7-9-31-10-8-28)16(24-25-19)12-17(29)32-22(4,5)6/h11,13H,7-10,12H2,1-6H3,(H,25,26)(H,27,30) |
| InChIKey | GTWZUMBKKVGHNC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|