C33H46N4O5 — CID 174192508
tert-butyl 2-[4-[[(1R)-1-(3-heptoxyphenyl)ethyl]amino]-6-morpholin-4-ylquinazolin-8-yl]oxyacetate (PubChem CID 174192508) has the molecular formula C33H46N4O5 and a molecular weight of 578.75 g/mol. Its IUPAC name is tert-butyl 2-[4-[[(1R)-1-(3-heptoxyphenyl)ethyl]amino]-6-morpholin-4-ylquinazolin-8-yl]oxyacetate.
| Compound Name | tert-butyl 2-[4-[[(1R)-1-(3-heptoxyphenyl)ethyl]amino]-6-morpholin-4-ylquinazolin-8-yl]oxyacetate |
|---|---|
| PubChem CID | 174192508 |
| Molecular Formula | C33H46N4O5 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | tert-butyl 2-[4-[[(1R)-1-(3-heptoxyphenyl)ethyl]amino]-6-morpholin-4-ylquinazolin-8-yl]oxyacetate |
| SMILES | CCCCCCCOc1cccc([C@@H](C)Nc2ncnc3c(OCC(=O)OC(C)(C)C)cc(N4CCOCC4)cc23)c1 |
| InChI | InChI=1S/C33H46N4O5/c1-6-7-8-9-10-16-40-27-13-11-12-25(19-27)24(2)36-32-28-20-26(37-14-17-39-18-15-37)21-29(31(28)34-23-35-32)41-22-30(38)42-33(3,4)5/h11-13,19-21,23-24H,6-10,14-18,22H2,1-5H3,(H,34,35,36)/t24-/m1/s1 |
| InChIKey | YYGQPSAPYCVWKH-XMMPIXPASA-N |
| XLogP | 6.71 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|