C24H33ClN4O3 — CID 178036730
tert-butyl N-[4-[(3-chloro-7-morpholin-4-ylisoquinolin-1-yl)amino]cyclohexyl]carbamate (PubChem CID 178036730) has the molecular formula C24H33ClN4O3 and a molecular weight of 461.01 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-chloro-7-morpholin-4-ylisoquinolin-1-yl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-chloro-7-morpholin-4-ylisoquinolin-1-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 178036730 |
| Molecular Formula | C24H33ClN4O3 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | tert-butyl N-[4-[(3-chloro-7-morpholin-4-ylisoquinolin-1-yl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2nc(Cl)cc3ccc(N4CCOCC4)cc23)CC1 |
| InChI | InChI=1S/C24H33ClN4O3/c1-24(2,3)32-23(30)27-18-7-5-17(6-8-18)26-22-20-15-19(29-10-12-31-13-11-29)9-4-16(20)14-21(25)28-22/h4,9,14-15,17-18H,5-8,10-13H2,1-3H3,(H,26,28)(H,27,30) |
| InChIKey | BPQSNWJSLHDPON-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|