C23H36BFN6O2 — CID 164904546
CID 164904546 (PubChem CID 164904546) has the molecular formula C23H36BFN6O2 and a molecular weight of 458.39 g/mol.
| Compound Name | CID 164904546 |
|---|---|
| PubChem CID | 164904546 |
| Molecular Formula | C23H36BFN6O2 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | — |
| SMILES | CC.[B]c1c(C)cc2c(NCCNC(=O)OC(C)(C)C)nc(N3CC(N(C)C)C3)nc2c1F |
| InChI | InChI=1S/C21H30BFN6O2.C2H6/c1-12-9-14-17(16(23)15(12)22)26-19(29-10-13(11-29)28(5)6)27-18(14)24-7-8-25-20(30)31-21(2,3)4;1-2/h9,13H,7-8,10-11H2,1-6H3,(H,25,30)(H,24,26,27);1-2H3 |
| InChIKey | GQIPBTCRVIFAPV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|