C26H29F4N3O5 — CID 164908272
N,N-bis[(2,4-dimethoxyphenyl)methyl]-4-methoxy-5-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine (PubChem CID 164908272) has the molecular formula C26H29F4N3O5 and a molecular weight of 539.53 g/mol. Its IUPAC name is N,N-bis[(2,4-dimethoxyphenyl)methyl]-4-methoxy-5-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine.
| Compound Name | N,N-bis[(2,4-dimethoxyphenyl)methyl]-4-methoxy-5-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 164908272 |
| Molecular Formula | C26H29F4N3O5 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | N,N-bis[(2,4-dimethoxyphenyl)methyl]-4-methoxy-5-(2,2,3,3-tetrafluoropropyl)pyrimidin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)c2ncc(CC(F)(F)C(F)F)c(OC)n2)c(OC)c1 |
| InChI | InChI=1S/C26H29F4N3O5/c1-34-19-8-6-16(21(10-19)36-3)14-33(15-17-7-9-20(35-2)11-22(17)37-4)25-31-13-18(23(32-25)38-5)12-26(29,30)24(27)28/h6-11,13,24H,12,14-15H2,1-5H3 |
| InChIKey | WTTHQKGKEPLDIJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 75.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|