C27H30BN3O6 — CID 166460483
[6-[bis[(2,4-dimethoxyphenyl)methyl]amino]-8-methyl-1,5-naphthyridin-3-yl]boronic acid (PubChem CID 166460483) has the molecular formula C27H30BN3O6 and a molecular weight of 503.36 g/mol. Its IUPAC name is [6-[bis[(2,4-dimethoxyphenyl)methyl]amino]-8-methyl-1,5-naphthyridin-3-yl]boronic acid.
| Compound Name | [6-[bis[(2,4-dimethoxyphenyl)methyl]amino]-8-methyl-1,5-naphthyridin-3-yl]boronic acid |
|---|---|
| PubChem CID | 166460483 |
| Molecular Formula | C27H30BN3O6 |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | [6-[bis[(2,4-dimethoxyphenyl)methyl]amino]-8-methyl-1,5-naphthyridin-3-yl]boronic acid |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)c2cc(C)c3ncc(B(O)O)cc3n2)c(OC)c1 |
| InChI | InChI=1S/C27H30BN3O6/c1-17-10-26(30-23-11-20(28(32)33)14-29-27(17)23)31(15-18-6-8-21(34-2)12-24(18)36-4)16-19-7-9-22(35-3)13-25(19)37-5/h6-14,32-33H,15-16H2,1-5H3 |
| InChIKey | QDIJHBODQZCNPR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|