C22H22N4O2 — CID 67003932
1-[(2,4-dimethoxyphenyl)methyl]-8-methylbenzo[f][1,7]naphthyridine-2,5-diamine (PubChem CID 67003932) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-8-methylbenzo[f][1,7]naphthyridine-2,5-diamine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-8-methylbenzo[f][1,7]naphthyridine-2,5-diamine |
|---|---|
| PubChem CID | 67003932 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-8-methylbenzo[f][1,7]naphthyridine-2,5-diamine |
| SMILES | COc1ccc(Cc2c(N)cnc3c(N)nc4cc(C)ccc4c23)c(OC)c1 |
| InChI | InChI=1S/C22H22N4O2/c1-12-4-7-15-18(8-12)26-22(24)21-20(15)16(17(23)11-25-21)9-13-5-6-14(27-2)10-19(13)28-3/h4-8,10-11H,9,23H2,1-3H3,(H2,24,26) |
| InChIKey | NPGJIZXPLWNYCB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|