C18H17BrClN3O2 — CID 157171651
6-bromo-2-chloro-4-[(2,4-dimethoxyphenyl)methyl]quinoline-3,5-diamine (PubChem CID 157171651) has the molecular formula C18H17BrClN3O2 and a molecular weight of 422.71 g/mol. Its IUPAC name is 6-bromo-2-chloro-4-[(2,4-dimethoxyphenyl)methyl]quinoline-3,5-diamine.
| Compound Name | 6-bromo-2-chloro-4-[(2,4-dimethoxyphenyl)methyl]quinoline-3,5-diamine |
|---|---|
| PubChem CID | 157171651 |
| Molecular Formula | C18H17BrClN3O2 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 6-bromo-2-chloro-4-[(2,4-dimethoxyphenyl)methyl]quinoline-3,5-diamine |
| SMILES | COc1ccc(Cc2c(N)c(Cl)nc3ccc(Br)c(N)c23)c(OC)c1 |
| InChI | InChI=1S/C18H17BrClN3O2/c1-24-10-4-3-9(14(8-10)25-2)7-11-15-13(23-18(20)16(11)21)6-5-12(19)17(15)22/h3-6,8H,7,21-22H2,1-2H3 |
| InChIKey | ANNNYQLREDYJQA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|