C26H28N4O4 — CID 174999834
[3,4-bis[(2,4-dimethoxyphenyl)methyl]-2,7-naphthyridin-1-yl]hydrazine (PubChem CID 174999834) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is [3,4-bis[(2,4-dimethoxyphenyl)methyl]-2,7-naphthyridin-1-yl]hydrazine.
| Compound Name | [3,4-bis[(2,4-dimethoxyphenyl)methyl]-2,7-naphthyridin-1-yl]hydrazine |
|---|---|
| PubChem CID | 174999834 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [3,4-bis[(2,4-dimethoxyphenyl)methyl]-2,7-naphthyridin-1-yl]hydrazine |
| SMILES | COc1ccc(Cc2nc(NN)c3cnccc3c2Cc2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H28N4O4/c1-31-18-7-5-16(24(13-18)33-3)11-21-20-9-10-28-15-22(20)26(30-27)29-23(21)12-17-6-8-19(32-2)14-25(17)34-4/h5-10,13-15H,11-12,27H2,1-4H3,(H,29,30) |
| InChIKey | WHHHMIILLBNGJG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|