C10H18LaN3O- — CID 164910088
ethanone;lanthanum;1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium-9-ide (PubChem CID 164910088) has the molecular formula C10H18LaN3O- and a molecular weight of 335.18 g/mol. Its IUPAC name is ethanone;lanthanum;1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium-9-ide.
| Compound Name | ethanone;lanthanum;1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium-9-ide |
|---|---|
| PubChem CID | 164910088 |
| Molecular Formula | C10H18LaN3O- |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | ethanone;lanthanum;1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ium-9-ide |
| SMILES | C[C-]=O.C[N+]1=C2[N-]CCCN2CCC1.[La] |
| InChI | InChI=1S/C8H15N3.C2H3O.La/c1-10-5-3-7-11-6-2-4-9-8(10)11;1-2-3;/h2-7H2,1H3;1H3;/q;-1; |
| InChIKey | DKHBRBJPHFPWMO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 37.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|