C13H25N3+2 — CID 158060069
N-methylacetonitrilium;1-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-1-ium (PubChem CID 158060069) has the molecular formula C13H25N3+2 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-methylacetonitrilium;1-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-1-ium.
| Compound Name | N-methylacetonitrilium;1-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-1-ium |
|---|---|
| PubChem CID | 158060069 |
| Molecular Formula | C13H25N3+2 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-methylacetonitrilium;1-methyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-1-ium |
| SMILES | CC#[N+]C.C[N+]1=C2CCCCCN2CCC1 |
| InChI | InChI=1S/C10H19N2.C3H6N/c1-11-7-5-9-12-8-4-2-3-6-10(11)12;1-3-4-2/h2-9H2,1H3;1-2H3/q2*+1 |
| InChIKey | ROGGNKIVGKJOOI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 10.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|