C10H17N2O2+ — CID 11217808
2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylic acid (PubChem CID 11217808) has the molecular formula C10H17N2O2+ and a molecular weight of 197.26 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylic acid.
| Compound Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 11217808 |
| Molecular Formula | C10H17N2O2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylic acid |
| SMILES | O=C(O)N1CCC[N+]2=C1CCCCC2 |
| InChI | InChI=1S/C10H16N2O2/c13-10(14)12-8-4-7-11-6-3-1-2-5-9(11)12/h1-8H2/p+1 |
| InChIKey | HCUHIJQASQSRQC-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|