C31H36ClN5O3 — CID 164915062
5-[2-[4-[(3-chloro-4-cyclopentyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915062) has the molecular formula C31H36ClN5O3 and a molecular weight of 562.11 g/mol. Its IUPAC name is 5-[2-[4-[(3-chloro-4-cyclopentyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(3-chloro-4-cyclopentyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915062 |
| Molecular Formula | C31H36ClN5O3 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 5-[2-[4-[(3-chloro-4-cyclopentyloxyphenyl)methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCOCCCCNCc1ccc(OC3CCCC3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C31H36ClN5O3/c32-27-17-21(7-10-29(27)40-23-5-1-2-6-23)19-34-12-3-4-15-39-16-14-36-31-25-11-13-35-20-26(25)24-9-8-22(30(33)38)18-28(24)37-31/h7-11,13,17-18,20,23,34H,1-6,12,14-16,19H2,(H2,33,38)(H,36,37) |
| InChIKey | YMHQJLDBABXRTR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|