C29H32F3N5O4 — CID 164915172
5-[2-[4-[[3-(2-hydroxyethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915172) has the molecular formula C29H32F3N5O4 and a molecular weight of 571.60 g/mol. Its IUPAC name is 5-[2-[4-[[3-(2-hydroxyethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(2-hydroxyethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915172 |
| Molecular Formula | C29H32F3N5O4 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 5-[2-[4-[[3-(2-hydroxyethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCOCCCCNCc1cc(CCO)cc(OC(F)(F)F)c1)c1ccncc12 |
| InChI | InChI=1S/C29H32F3N5O4/c30-29(31,32)41-22-14-19(6-10-38)13-20(15-22)17-34-7-1-2-11-40-12-9-36-28-24-5-8-35-18-25(24)23-4-3-21(27(33)39)16-26(23)37-28/h3-5,8,13-16,18,34,38H,1-2,6-7,9-12,17H2,(H2,33,39)(H,36,37) |
| InChIKey | YXLGGUSAIJYAAD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|