C14H15N4O+ — CID 164919106
1-(2,3,4-trimethyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-3-ium-6-yl)cyclopropane-1-carbonitrile (PubChem CID 164919106) has the molecular formula C14H15N4O+ and a molecular weight of 255.30 g/mol. Its IUPAC name is 1-(2,3,4-trimethyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-3-ium-6-yl)cyclopropane-1-carbonitrile.
| Compound Name | 1-(2,3,4-trimethyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-3-ium-6-yl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 164919106 |
| Molecular Formula | C14H15N4O+ |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-(2,3,4-trimethyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-3-ium-6-yl)cyclopropane-1-carbonitrile |
| SMILES | Cc1nc2[nH]c(=O)c(C3(C#N)CC3)cc2c(C)[n+]1C |
| InChI | InChI=1S/C14H14N4O/c1-8-10-6-11(14(7-15)4-5-14)13(19)17-12(10)16-9(2)18(8)3/h6H,4-5H2,1-3H3/p+1 |
| InChIKey | KGUCCHQTEPSILF-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|