C14H29NO — CID 164922707
2-[(E)-3,3-dimethylbut-1-enyl]-1,4-dimethylpyrrolidine;methoxymethane (PubChem CID 164922707) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-[(E)-3,3-dimethylbut-1-enyl]-1,4-dimethylpyrrolidine;methoxymethane.
| Compound Name | 2-[(E)-3,3-dimethylbut-1-enyl]-1,4-dimethylpyrrolidine;methoxymethane |
|---|---|
| PubChem CID | 164922707 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-[(E)-3,3-dimethylbut-1-enyl]-1,4-dimethylpyrrolidine;methoxymethane |
| SMILES | CC1CC(/C=C/C(C)(C)C)N(C)C1.COC |
| InChI | InChI=1S/C12H23N.C2H6O/c1-10-8-11(13(5)9-10)6-7-12(2,3)4;1-3-2/h6-7,10-11H,8-9H2,1-5H3;1-2H3/b7-6+; |
| InChIKey | ACWQKIIHBVVVSJ-UHDJGPCESA-N |
| XLogP | 3.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|