C32H41F4N3 — CID 164923037
2-[4-[(3R)-2-(2,2-difluoropropyl)-3,6-dimethyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-9-prop-2-enyl-2,9-diazaspiro[4.6]undecane (PubChem CID 164923037) has the molecular formula C32H41F4N3 and a molecular weight of 543.69 g/mol. Its IUPAC name is 2-[4-[(3R)-2-(2,2-difluoropropyl)-3,6-dimethyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-9-prop-2-enyl-2,9-diazaspiro[4.6]undecane.
| Compound Name | 2-[4-[(3R)-2-(2,2-difluoropropyl)-3,6-dimethyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-9-prop-2-enyl-2,9-diazaspiro[4.6]undecane |
|---|---|
| PubChem CID | 164923037 |
| Molecular Formula | C32H41F4N3 |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | 2-[4-[(3R)-2-(2,2-difluoropropyl)-3,6-dimethyl-3,4-dihydro-1H-isoquinolin-1-yl]-3,5-difluorophenyl]-9-prop-2-enyl-2,9-diazaspiro[4.6]undecane |
| SMILES | C=CCN1CCCC2(CC1)CCN(c1cc(F)c(C3c4ccc(C)cc4C[C@@H](C)N3CC(C)(F)F)c(F)c1)C2 |
| InChI | InChI=1S/C32H41F4N3/c1-5-12-37-13-6-9-32(10-14-37)11-15-38(21-32)25-18-27(33)29(28(34)19-25)30-26-8-7-22(2)16-24(26)17-23(3)39(30)20-31(4,35)36/h5,7-8,16,18-19,23,30H,1,6,9-15,17,20-21H2,2-4H3/t23-,30?,32?/m1/s1 |
| InChIKey | DWPSMACJTRXZQO-KJYSYULASA-N |
| XLogP | 7.13 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|