C34H38N2O3 — CID 164923544
2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,8-diazaspiro[3.7]undecan-8-yl]acetic acid (PubChem CID 164923544) has the molecular formula C34H38N2O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is 2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,8-diazaspiro[3.7]undecan-8-yl]acetic acid.
| Compound Name | 2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,8-diazaspiro[3.7]undecan-8-yl]acetic acid |
|---|---|
| PubChem CID | 164923544 |
| Molecular Formula | C34H38N2O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,8-diazaspiro[3.7]undecan-8-yl]acetic acid |
| SMILES | O=C(O)CN1CCCC2(CCC1)CN(c1ccc(C3=C(c4ccccc4)CCCc4cc(O)ccc43)cc1)C2 |
| InChI | InChI=1S/C34H38N2O3/c37-29-15-16-31-27(21-29)9-4-10-30(25-7-2-1-3-8-25)33(31)26-11-13-28(14-12-26)36-23-34(24-36)17-5-19-35(20-6-18-34)22-32(38)39/h1-3,7-8,11-16,21,37H,4-6,9-10,17-20,22-24H2,(H,38,39) |
| InChIKey | BJTNMMJJUQEOIT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|