C31H32N2O3 — CID 171719843
2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,7-diazaspiro[3.4]octan-7-yl]acetic acid (PubChem CID 171719843) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,7-diazaspiro[3.4]octan-7-yl]acetic acid.
| Compound Name | 2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,7-diazaspiro[3.4]octan-7-yl]acetic acid |
|---|---|
| PubChem CID | 171719843 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-[2-[4-(2-hydroxy-6-phenyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-2,7-diazaspiro[3.4]octan-7-yl]acetic acid |
| SMILES | O=C(O)CN1CCC2(C1)CN(c1ccc(C3=C(c4ccccc4)CCCc4cc(O)ccc43)cc1)C2 |
| InChI | InChI=1S/C31H32N2O3/c34-26-13-14-28-24(17-26)7-4-8-27(22-5-2-1-3-6-22)30(28)23-9-11-25(12-10-23)33-20-31(21-33)15-16-32(19-31)18-29(35)36/h1-3,5-6,9-14,17,34H,4,7-8,15-16,18-21H2,(H,35,36) |
| InChIKey | RXIGHPQXRZGVTK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|