C19H25ClN6O4S — CID 164925844
2-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]ethoxy]ethanesulfonyl chloride (PubChem CID 164925844) has the molecular formula C19H25ClN6O4S and a molecular weight of 468.97 g/mol. Its IUPAC name is 2-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]ethoxy]ethanesulfonyl chloride.
| Compound Name | 2-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]ethoxy]ethanesulfonyl chloride |
|---|---|
| PubChem CID | 164925844 |
| Molecular Formula | C19H25ClN6O4S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]-methylamino]ethoxy]ethanesulfonyl chloride |
| SMILES | CCc1cnn2c(NCc3ccc[n+]([O-])c3)cc(N(C)CCOCCS(=O)(=O)Cl)nc12 |
| InChI | InChI=1S/C19H25ClN6O4S/c1-3-16-13-22-26-17(21-12-15-5-4-6-25(27)14-15)11-18(23-19(16)26)24(2)7-8-30-9-10-31(20,28)29/h4-6,11,13-14,21H,3,7-10,12H2,1-2H3 |
| InChIKey | VXJHWGXDVVRUEH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|