C13H12BrN5O2 — CID 21067039
3-bromo-5-methoxy-N-[(1-oxidopyridin-1-ium-3-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 21067039) has the molecular formula C13H12BrN5O2 and a molecular weight of 350.18 g/mol. Its IUPAC name is 3-bromo-5-methoxy-N-[(1-oxidopyridin-1-ium-3-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-bromo-5-methoxy-N-[(1-oxidopyridin-1-ium-3-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 21067039 |
| Molecular Formula | C13H12BrN5O2 |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 3-bromo-5-methoxy-N-[(1-oxidopyridin-1-ium-3-yl)methyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | COc1cc(NCc2ccc[n+]([O-])c2)n2ncc(Br)c2n1 |
| InChI | InChI=1S/C13H12BrN5O2/c1-21-12-5-11(19-13(17-12)10(14)7-16-19)15-6-9-3-2-4-18(20)8-9/h2-5,7-8,15H,6H2,1H3 |
| InChIKey | KBHUDZWRGJMCPE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|