C25H26N10O4S — CID 170537926
N-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethyl]-4-(1,2,4-triazol-1-ylsulfonyl)benzamide (PubChem CID 170537926) has the molecular formula C25H26N10O4S and a molecular weight of 562.62 g/mol. Its IUPAC name is N-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethyl]-4-(1,2,4-triazol-1-ylsulfonyl)benzamide.
| Compound Name | N-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethyl]-4-(1,2,4-triazol-1-ylsulfonyl)benzamide |
|---|---|
| PubChem CID | 170537926 |
| Molecular Formula | C25H26N10O4S |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | N-[2-[[3-ethyl-7-[(1-oxidopyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]ethyl]-4-(1,2,4-triazol-1-ylsulfonyl)benzamide |
| SMILES | CCc1cnn2c(NCc3ccc[n+]([O-])c3)cc(NCCNC(=O)c3ccc(S(=O)(=O)n4cncn4)cc3)nc12 |
| InChI | InChI=1S/C25H26N10O4S/c1-2-19-14-30-35-23(29-13-18-4-3-11-33(37)15-18)12-22(32-24(19)35)27-9-10-28-25(36)20-5-7-21(8-6-20)40(38,39)34-17-26-16-31-34/h3-8,11-12,14-17,29H,2,9-10,13H2,1H3,(H,27,32)(H,28,36) |
| InChIKey | JXVLYLITQJRMGS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|