C58H35N7 — CID 164927553
1,2,3,4-tetradeuterio-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-3,5-bis(1,2,3,4-tetradeuteriocarbazol-9-yl)phenyl]carbazole (PubChem CID 164927553) has the molecular formula C58H35N7 and a molecular weight of 842.04 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-3,5-bis(1,2,3,4-tetradeuteriocarbazol-9-yl)phenyl]carbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-3,5-bis(1,2,3,4-tetradeuteriocarbazol-9-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 164927553 |
| Molecular Formula | C58H35N7 |
| Molecular Weight | 842.04 g/mol |
| Exact Mass | 841.37 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-isocyano-3,5-bis(1,2,3,4-tetradeuteriocarbazol-9-yl)phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1ccccc1n2-c1cc(-n2c3ccccc3c3c([2H])c([2H])c([2H])c([2H])c32)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-n2c3ccccc3c3c([2H])c([2H])c([2H])c([2H])c32)c1[N+]#[C-] |
| InChI | InChI=1S/C58H35N7/c1-59-54-52(64-47-32-16-10-26-41(47)42-27-11-17-33-48(42)64)36-51(63-45-30-14-8-24-39(45)40-25-9-15-31-46(40)63)53(55(54)65-49-34-18-12-28-43(49)44-29-13-19-35-50(44)65)58-61-56(37-20-4-2-5-21-37)60-57(62-58)38-22-6-3-7-23-38/h2-36H/i8D,10D,12D,14D,16D,18D,24D,26D,28D,30D,32D,34D |
| InChIKey | PSWHBVKTXLRDCT-BDWAVYDASA-N |
| XLogP | 14.71 |
| TPSA | 57.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.04 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|