C17H32O7Si — CID 164929046
(3S,5R,8R,9S)-11,11-ditert-butyl-5-methoxy-5-methyl-2,4,6,10,12-pentaoxa-11-silatricyclo[7.4.0.03,7]tridecan-8-ol (PubChem CID 164929046) has the molecular formula C17H32O7Si and a molecular weight of 376.52 g/mol. Its IUPAC name is (3S,5R,8R,9S)-11,11-ditert-butyl-5-methoxy-5-methyl-2,4,6,10,12-pentaoxa-11-silatricyclo[7.4.0.03,7]tridecan-8-ol.
| Compound Name | (3S,5R,8R,9S)-11,11-ditert-butyl-5-methoxy-5-methyl-2,4,6,10,12-pentaoxa-11-silatricyclo[7.4.0.03,7]tridecan-8-ol |
|---|---|
| PubChem CID | 164929046 |
| Molecular Formula | C17H32O7Si |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3S,5R,8R,9S)-11,11-ditert-butyl-5-methoxy-5-methyl-2,4,6,10,12-pentaoxa-11-silatricyclo[7.4.0.03,7]tridecan-8-ol |
| SMILES | CO[C@]1(C)OC2[C@@H](OC3CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]3[C@@H]2O)O1 |
| InChI | InChI=1S/C17H32O7Si/c1-15(2,3)25(16(4,5)6)20-9-10-12(24-25)11(18)13-14(21-10)23-17(7,19-8)22-13/h10-14,18H,9H2,1-8H3/t10?,11-,12+,13?,14-,17+/m0/s1 |
| InChIKey | VDPAKZXHBCGPPP-ARRXPDSFSA-N |
| XLogP | 2.27 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|