C19H17BrN4O6S — CID 164934864
3-[(6-bromo-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-1-oxidopyridin-1-ium-2-carboxylic acid (PubChem CID 164934864) has the molecular formula C19H17BrN4O6S and a molecular weight of 509.34 g/mol. Its IUPAC name is 3-[(6-bromo-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-1-oxidopyridin-1-ium-2-carboxylic acid.
| Compound Name | 3-[(6-bromo-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-1-oxidopyridin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 164934864 |
| Molecular Formula | C19H17BrN4O6S |
| Molecular Weight | 509.34 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 3-[(6-bromo-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-1-oxidopyridin-1-ium-2-carboxylic acid |
| SMILES | O=C(O)c1c(Nc2c(S(=O)(=O)N3CCOCC3)cnc3ccc(Br)cc23)ccc[n+]1[O-] |
| InChI | InChI=1S/C19H17BrN4O6S/c20-12-3-4-14-13(10-12)17(22-15-2-1-5-24(27)18(15)19(25)26)16(11-21-14)31(28,29)23-6-8-30-9-7-23/h1-5,10-11H,6-9H2,(H,21,22)(H,25,26) |
| InChIKey | XQGMAWIYVBXKRY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|