C21H20ClN3O6S — CID 155235436
2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-6-methoxybenzoic acid (PubChem CID 155235436) has the molecular formula C21H20ClN3O6S and a molecular weight of 477.93 g/mol. Its IUPAC name is 2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-6-methoxybenzoic acid.
| Compound Name | 2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-6-methoxybenzoic acid |
|---|---|
| PubChem CID | 155235436 |
| Molecular Formula | C21H20ClN3O6S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-6-methoxybenzoic acid |
| SMILES | COc1cccc(Nc2c(S(=O)(=O)N3CCOCC3)cnc3ccc(Cl)cc23)c1C(=O)O |
| InChI | InChI=1S/C21H20ClN3O6S/c1-30-17-4-2-3-16(19(17)21(26)27)24-20-14-11-13(22)5-6-15(14)23-12-18(20)32(28,29)25-7-9-31-10-8-25/h2-6,11-12H,7-10H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | WOZTXMVUOSIYIJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |