C26H29BClN3O7S — CID 171781277
2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 171781277) has the molecular formula C26H29BClN3O7S and a molecular weight of 573.86 g/mol. Its IUPAC name is 2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 171781277 |
| Molecular Formula | C26H29BClN3O7S |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(c2ccc(C(=O)O)c(Nc3c(S(=O)(=O)N4CCOCC4)cnc4ccc(Cl)cc34)c2)OC1(C)C |
| InChI | InChI=1S/C26H29BClN3O7S/c1-25(2)26(3,4)38-27(37-25)16-5-7-18(24(32)33)21(13-16)30-23-19-14-17(28)6-8-20(19)29-15-22(23)39(34,35)31-9-11-36-12-10-31/h5-8,13-15H,9-12H2,1-4H3,(H,29,30)(H,32,33) |
| InChIKey | ZEUHFOOMRWEGJZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|