C27H31BClN3O6S — CID 174074766
[6-chloro-4-[2-methoxycarbonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]quinolin-3-yl]-morpholin-4-yl-oxidosulfanium (PubChem CID 174074766) has the molecular formula C27H31BClN3O6S and a molecular weight of 571.89 g/mol. Its IUPAC name is [6-chloro-4-[2-methoxycarbonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]quinolin-3-yl]-morpholin-4-yl-oxidosulfanium.
| Compound Name | [6-chloro-4-[2-methoxycarbonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]quinolin-3-yl]-morpholin-4-yl-oxidosulfanium |
|---|---|
| PubChem CID | 174074766 |
| Molecular Formula | C27H31BClN3O6S |
| Molecular Weight | 571.89 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | [6-chloro-4-[2-methoxycarbonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]quinolin-3-yl]-morpholin-4-yl-oxidosulfanium |
| SMILES | COC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)ccc1Nc1c([S+]([O-])N2CCOCC2)cnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C27H31BClN3O6S/c1-26(2)27(3,4)38-28(37-26)17-6-8-22(20(14-17)25(33)35-5)31-24-19-15-18(29)7-9-21(19)30-16-23(24)39(34)32-10-12-36-13-11-32/h6-9,14-16H,10-13H2,1-5H3,(H,30,31) |
| InChIKey | RHBKWRQCEDLJPY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.89 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|