C20H19BClN3O6S — CID 174074768
[4-(4-borono-2-carboxyanilino)-6-chloroquinolin-3-yl]-morpholin-4-yl-oxidosulfanium (PubChem CID 174074768) has the molecular formula C20H19BClN3O6S and a molecular weight of 475.72 g/mol. Its IUPAC name is [4-(4-borono-2-carboxyanilino)-6-chloroquinolin-3-yl]-morpholin-4-yl-oxidosulfanium.
| Compound Name | [4-(4-borono-2-carboxyanilino)-6-chloroquinolin-3-yl]-morpholin-4-yl-oxidosulfanium |
|---|---|
| PubChem CID | 174074768 |
| Molecular Formula | C20H19BClN3O6S |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [4-(4-borono-2-carboxyanilino)-6-chloroquinolin-3-yl]-morpholin-4-yl-oxidosulfanium |
| SMILES | O=C(O)c1cc(B(O)O)ccc1Nc1c([S+]([O-])N2CCOCC2)cnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H19BClN3O6S/c22-13-2-4-16-14(10-13)19(18(11-23-16)32(30)25-5-7-31-8-6-25)24-17-3-1-12(21(28)29)9-15(17)20(26)27/h1-4,9-11,28-29H,5-8H2,(H,23,24)(H,26,27) |
| InChIKey | VTOVIXZYMWINAX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|