C20H19ClN4O7S2 — CID 172550822
3-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-5-sulfamoylbenzoic acid (PubChem CID 172550822) has the molecular formula C20H19ClN4O7S2 and a molecular weight of 526.98 g/mol. Its IUPAC name is 3-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-5-sulfamoylbenzoic acid.
| Compound Name | 3-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 172550822 |
| Molecular Formula | C20H19ClN4O7S2 |
| Molecular Weight | 526.98 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 3-[(6-chloro-3-morpholin-4-ylsulfonylquinolin-4-yl)amino]-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(Nc2c(S(=O)(=O)N3CCOCC3)cnc3ccc(Cl)cc23)cc(C(=O)O)c1 |
| InChI | InChI=1S/C20H19ClN4O7S2/c21-13-1-2-17-16(9-13)19(18(11-23-17)34(30,31)25-3-5-32-6-4-25)24-14-7-12(20(26)27)8-15(10-14)33(22,28)29/h1-2,7-11H,3-6H2,(H,23,24)(H,26,27)(H2,22,28,29) |
| InChIKey | DPYOHBLJIUPUGI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 168.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.98 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |