C43H33OP — CID 164937828
1-(7-diphenylphosphoryl-9,9-dimethylfluoren-2-yl)-4,10c-dihydropyrene (PubChem CID 164937828) has the molecular formula C43H33OP and a molecular weight of 596.71 g/mol. Its IUPAC name is 1-(7-diphenylphosphoryl-9,9-dimethylfluoren-2-yl)-4,10c-dihydropyrene.
| Compound Name | 1-(7-diphenylphosphoryl-9,9-dimethylfluoren-2-yl)-4,10c-dihydropyrene |
|---|---|
| PubChem CID | 164937828 |
| Molecular Formula | C43H33OP |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 1-(7-diphenylphosphoryl-9,9-dimethylfluoren-2-yl)-4,10c-dihydropyrene |
| SMILES | CC1(C)c2cc(-c3ccc4c5c3C=CC3=CC=CC(=CC4)C35)ccc2-c2ccc(P(=O)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C43H33OP/c1-43(2)39-26-31(35-22-18-30-17-16-28-10-9-11-29-19-24-38(35)42(30)41(28)29)20-23-36(39)37-25-21-34(27-40(37)43)45(44,32-12-5-3-6-13-32)33-14-7-4-8-15-33/h3-16,18-27,41H,17H2,1-2H3 |
| InChIKey | FZPIRWFSQRKPEJ-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|