C8H14N4O — CID 164939936
5-azido-1-isocyano-3,3-dimethylpentan-2-ol (PubChem CID 164939936) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-azido-1-isocyano-3,3-dimethylpentan-2-ol.
| Compound Name | 5-azido-1-isocyano-3,3-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 164939936 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 5-azido-1-isocyano-3,3-dimethylpentan-2-ol |
| SMILES | [C-]#[N+]CC(O)C(C)(C)CCN=[N+]=[N-] |
| InChI | InChI=1S/C8H14N4O/c1-8(2,4-5-11-12-9)7(13)6-10-3/h7,13H,4-6H2,1-2H3 |
| InChIKey | RDYCFFSPTYLZGH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|