C8H16N3O3S- — CID 166006031
6-azido-3-hydroxy-4,4-dimethylhexane-2-sulfinate (PubChem CID 166006031) has the molecular formula C8H16N3O3S- and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-azido-3-hydroxy-4,4-dimethylhexane-2-sulfinate.
| Compound Name | 6-azido-3-hydroxy-4,4-dimethylhexane-2-sulfinate |
|---|---|
| PubChem CID | 166006031 |
| Molecular Formula | C8H16N3O3S- |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-azido-3-hydroxy-4,4-dimethylhexane-2-sulfinate |
| SMILES | CC(C(O)C(C)(C)CCN=[N+]=[N-])S(=O)[O-] |
| InChI | InChI=1S/C8H17N3O3S/c1-6(15(13)14)7(12)8(2,3)4-5-10-11-9/h6-7,12H,4-5H2,1-3H3,(H,13,14)/p-1 |
| InChIKey | GTUYVDUWVOMUHJ-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|