C24H21FN3O3PS2 — CID 164944080
(3R)-2-[(11S)-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-phosphanyloxy-5-thia-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 164944080) has the molecular formula C24H21FN3O3PS2 and a molecular weight of 513.56 g/mol. Its IUPAC name is (3R)-2-[(11S)-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-phosphanyloxy-5-thia-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-2-[(11S)-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-phosphanyloxy-5-thia-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 164944080 |
| Molecular Formula | C24H21FN3O3PS2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | (3R)-2-[(11S)-7-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-phosphanyloxy-5-thia-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(OP)c(=O)ccn2N([C@@H]2c3ccccc3SCc3c(F)cccc32)[C@@H]2CSCCN12 |
| InChI | InChI=1S/C24H21FN3O3PS2/c25-17-6-3-5-14-16(17)12-34-19-7-2-1-4-15(19)21(14)28-20-13-33-11-10-26(20)24(30)22-23(31-32)18(29)8-9-27(22)28/h1-9,20-21H,10-13,32H2/t20-,21+/m1/s1 |
| InChIKey | BYPVZGXUNISIBY-RTWAWAEBSA-N |
| XLogP | 4.02 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|