C23H29NO6 — CID 164946678
dimethyl 2-[[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]-2-prop-2-enylpropanedioate (PubChem CID 164946678) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is dimethyl 2-[[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]-2-prop-2-enylpropanedioate.
| Compound Name | dimethyl 2-[[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 164946678 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | dimethyl 2-[[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(Cc1c(C)n(C(=O)OC(C)(C)C)c2ccccc12)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C23H29NO6/c1-8-13-23(19(25)28-6,20(26)29-7)14-17-15(2)24(21(27)30-22(3,4)5)18-12-10-9-11-16(17)18/h8-12H,1,13-14H2,2-7H3 |
| InChIKey | VQJBZVFHBQAIGG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|