C18H16N2O7 — CID 6474609
dimethyl 10-[(E)-2-nitroethenyl]-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate (PubChem CID 6474609) has the molecular formula C18H16N2O7 and a molecular weight of 372.33 g/mol. Its IUPAC name is dimethyl 10-[(E)-2-nitroethenyl]-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate.
| Compound Name | dimethyl 10-[(E)-2-nitroethenyl]-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate |
|---|---|
| PubChem CID | 6474609 |
| Molecular Formula | C18H16N2O7 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | dimethyl 10-[(E)-2-nitroethenyl]-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCC(=O)n2c1c(/C=C/[N+](=O)[O-])c1ccccc12 |
| InChI | InChI=1S/C18H16N2O7/c1-26-16(22)18(17(23)27-2)9-7-14(21)20-13-6-4-3-5-11(13)12(15(18)20)8-10-19(24)25/h3-6,8,10H,7,9H2,1-2H3/b10-8+ |
| InChIKey | BVUVZXSVUJKHJH-CSKARUKUSA-N |
| XLogP | 1.91 |
| TPSA | 117.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|