C20H16FNO3 — CID 135068236
methyl 9-(4-fluorophenyl)-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indole-7-carboxylate (PubChem CID 135068236) has the molecular formula C20H16FNO3 and a molecular weight of 337.35 g/mol. Its IUPAC name is methyl 9-(4-fluorophenyl)-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indole-7-carboxylate.
| Compound Name | methyl 9-(4-fluorophenyl)-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indole-7-carboxylate |
|---|---|
| PubChem CID | 135068236 |
| Molecular Formula | C20H16FNO3 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | methyl 9-(4-fluorophenyl)-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indole-7-carboxylate |
| SMILES | COC(=O)C1CC(c2ccc(F)cc2)c2cc3ccccc3n2C1=O |
| InChI | InChI=1S/C20H16FNO3/c1-25-20(24)16-11-15(12-6-8-14(21)9-7-12)18-10-13-4-2-3-5-17(13)22(18)19(16)23/h2-10,15-16H,11H2,1H3 |
| InChIKey | QKUACROCXWAZRJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|