C10H15NO3 — CID 164948722
2-(3,4-dioxocyclohexyl)-N,N-dimethylacetamide (PubChem CID 164948722) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(3,4-dioxocyclohexyl)-N,N-dimethylacetamide.
| Compound Name | 2-(3,4-dioxocyclohexyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 164948722 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-(3,4-dioxocyclohexyl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CC1CCC(=O)C(=O)C1 |
| InChI | InChI=1S/C10H15NO3/c1-11(2)10(14)6-7-3-4-8(12)9(13)5-7/h7H,3-6H2,1-2H3 |
| InChIKey | AABRDMARGKHAKK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|