C8H11NO3 — CID 167051980
2-(3,4-dioxocyclohexyl)acetamide (PubChem CID 167051980) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(3,4-dioxocyclohexyl)acetamide.
| Compound Name | 2-(3,4-dioxocyclohexyl)acetamide |
|---|---|
| PubChem CID | 167051980 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-(3,4-dioxocyclohexyl)acetamide |
| SMILES | NC(=O)CC1CCC(=O)C(=O)C1 |
| InChI | InChI=1S/C8H11NO3/c9-8(12)4-5-1-2-6(10)7(11)3-5/h5H,1-4H2,(H2,9,12) |
| InChIKey | VIJQVCSMSNSZAD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|