C35H64O8 — CID 164949815
bis[3,5-bis(3-hydroxypentan-3-yl)cyclohexyl] propanedioate (PubChem CID 164949815) has the molecular formula C35H64O8 and a molecular weight of 612.89 g/mol. Its IUPAC name is bis[3,5-bis(3-hydroxypentan-3-yl)cyclohexyl] propanedioate.
| Compound Name | bis[3,5-bis(3-hydroxypentan-3-yl)cyclohexyl] propanedioate |
|---|---|
| PubChem CID | 164949815 |
| Molecular Formula | C35H64O8 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.46 |
| IUPAC Name | bis[3,5-bis(3-hydroxypentan-3-yl)cyclohexyl] propanedioate |
| SMILES | CCC(O)(CC)C1CC(OC(=O)CC(=O)OC2CC(C(O)(CC)CC)CC(C(O)(CC)CC)C2)CC(C(O)(CC)CC)C1 |
| InChI | InChI=1S/C35H64O8/c1-9-32(38,10-2)24-17-25(33(39,11-3)12-4)20-28(19-24)42-30(36)23-31(37)43-29-21-26(34(40,13-5)14-6)18-27(22-29)35(41,15-7)16-8/h24-29,38-41H,9-23H2,1-8H3 |
| InChIKey | OYBVOLLXMVZJER-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|