C16H30O — CID 164950043
1-[(1S,3S)-3-(2,2-dimethylpropyl)cyclohexyl]pentan-2-one (PubChem CID 164950043) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 1-[(1S,3S)-3-(2,2-dimethylpropyl)cyclohexyl]pentan-2-one.
| Compound Name | 1-[(1S,3S)-3-(2,2-dimethylpropyl)cyclohexyl]pentan-2-one |
|---|---|
| PubChem CID | 164950043 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-[(1S,3S)-3-(2,2-dimethylpropyl)cyclohexyl]pentan-2-one |
| SMILES | CCCC(=O)C[C@H]1CCC[C@H](CC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30O/c1-5-7-15(17)11-13-8-6-9-14(10-13)12-16(2,3)4/h13-14H,5-12H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | KNMYVUNCBILOAK-KBPBESRZSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |